About cyclohexyl-(1,1-dioxo-1,4-thiazinan-4-yl)methanone
cyclohexyl-(1,1-dioxo-1,4-thiazinan-4-yl)methanone (PubChem CID 71933484) has the molecular formula C11H19NO3S
and a molecular weight of 245.34 g/mol. Its IUPAC name is cyclohexyl-(1,1-dioxo-1,4-thiazinan-4-yl)methanone.
Molecular Properties
| Compound Name | cyclohexyl-(1,1-dioxo-1,4-thiazinan-4-yl)methanone |
| PubChem CID | 71933484 |
| Molecular Formula | C11H19NO3S |
| Molecular Weight | 245.34 g/mol |
| Exact Mass | 245.11 |
| IUPAC Name | cyclohexyl-(1,1-dioxo-1,4-thiazinan-4-yl)methanone |
| SMILES | O=C(C1CCCCC1)N1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C11H19NO3S/c13-11(10-4-2-1-3-5-10)12-6-8-16(14,15)9-7-12/h10H,1-9H2 |
| InChIKey | JGPAIEGDINYFLT-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.34 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze cyclohexyl-(1,1-dioxo-1,4-thiazinan-4-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexyl-(1,1-dioxo-1,4-thiazinan-4-yl)methanone?
The IUPAC name of cyclohexyl-(1,1-dioxo-1,4-thiazinan-4-yl)methanone (CID 71933484) is cyclohexyl-(1,1-dioxo-1,4-thiazinan-4-yl)methanone.
What is the SMILES notation for cyclohexyl-(1,1-dioxo-1,4-thiazinan-4-yl)methanone?
The canonical SMILES for cyclohexyl-(1,1-dioxo-1,4-thiazinan-4-yl)methanone is O=C(C1CCCCC1)N1CCS(=O)(=O)CC1.
What is the InChIKey of cyclohexyl-(1,1-dioxo-1,4-thiazinan-4-yl)methanone?
The InChIKey is JGPAIEGDINYFLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NO3S/c13-11(10-4-2-1-3-5-10)12-6-8-16(14,15)9-7-12/h10H,1-9H2.
What are the key properties of cyclohexyl-(1,1-dioxo-1,4-thiazinan-4-yl)methanone?
cyclohexyl-(1,1-dioxo-1,4-thiazinan-4-yl)methanone has a molecular weight of 245.34 g/mol, XLogP of 0.82, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexyl-(1,1-dioxo-1,4-thiazinan-4-yl)methanone is sourced from PubChem (CID 71933484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).