About (1-methyl-3,5-dihydro-2H-1,4-benzodiazepin-4-yl)-(1-methylsulfonylcyclopentyl)methanone
(1-methyl-3,5-dihydro-2H-1,4-benzodiazepin-4-yl)-(1-methylsulfonylcyclopentyl)methanone (PubChem CID 71933742) has the molecular formula C17H24N2O3S
and a molecular weight of 336.46 g/mol. Its IUPAC name is (1-methyl-3,5-dihydro-2H-1,4-benzodiazepin-4-yl)-(1-methylsulfonylcyclopentyl)methanone.
Molecular Properties
| Compound Name | (1-methyl-3,5-dihydro-2H-1,4-benzodiazepin-4-yl)-(1-methylsulfonylcyclopentyl)methanone |
| PubChem CID | 71933742 |
| Molecular Formula | C17H24N2O3S |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | (1-methyl-3,5-dihydro-2H-1,4-benzodiazepin-4-yl)-(1-methylsulfonylcyclopentyl)methanone |
| SMILES | CN1CCN(C(=O)C2(S(C)(=O)=O)CCCC2)Cc2ccccc21 |
| InChI | InChI=1S/C17H24N2O3S/c1-18-11-12-19(13-14-7-3-4-8-15(14)18)16(20)17(23(2,21)22)9-5-6-10-17/h3-4,7-8H,5-6,9-13H2,1-2H3 |
| InChIKey | ZOQCUQGIRVLNBB-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (1-methyl-3,5-dihydro-2H-1,4-benzodiazepin-4-yl)-(1-methylsulfonylcyclopentyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-methyl-3,5-dihydro-2H-1,4-benzodiazepin-4-yl)-(1-methylsulfonylcyclopentyl)methanone?
The IUPAC name of (1-methyl-3,5-dihydro-2H-1,4-benzodiazepin-4-yl)-(1-methylsulfonylcyclopentyl)methanone (CID 71933742) is (1-methyl-3,5-dihydro-2H-1,4-benzodiazepin-4-yl)-(1-methylsulfonylcyclopentyl)methanone.
What is the SMILES notation for (1-methyl-3,5-dihydro-2H-1,4-benzodiazepin-4-yl)-(1-methylsulfonylcyclopentyl)methanone?
The canonical SMILES for (1-methyl-3,5-dihydro-2H-1,4-benzodiazepin-4-yl)-(1-methylsulfonylcyclopentyl)methanone is CN1CCN(C(=O)C2(S(C)(=O)=O)CCCC2)Cc2ccccc21.
What is the InChIKey of (1-methyl-3,5-dihydro-2H-1,4-benzodiazepin-4-yl)-(1-methylsulfonylcyclopentyl)methanone?
The InChIKey is ZOQCUQGIRVLNBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24N2O3S/c1-18-11-12-19(13-14-7-3-4-8-15(14)18)16(20)17(23(2,21)22)9-5-6-10-17/h3-4,7-8H,5-6,9-13H2,1-2H3.
What are the key properties of (1-methyl-3,5-dihydro-2H-1,4-benzodiazepin-4-yl)-(1-methylsulfonylcyclopentyl)methanone?
(1-methyl-3,5-dihydro-2H-1,4-benzodiazepin-4-yl)-(1-methylsulfonylcyclopentyl)methanone has a molecular weight of 336.46 g/mol, XLogP of 1.82, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1-methyl-3,5-dihydro-2H-1,4-benzodiazepin-4-yl)-(1-methylsulfonylcyclopentyl)methanone is sourced from PubChem (CID 71933742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).