C15H19N3O4 — CID 71933978
N-[1-(2-hydroxyethyl)-3-(2-methylfuran-3-yl)pyrazol-5-yl]oxolane-2-carboxamide (PubChem CID 71933978) has the molecular formula C15H19N3O4 and a molecular weight of 305.33 g/mol. Its IUPAC name is N-[1-(2-hydroxyethyl)-3-(2-methylfuran-3-yl)pyrazol-5-yl]oxolane-2-carboxamide.
| Compound Name | N-[1-(2-hydroxyethyl)-3-(2-methylfuran-3-yl)pyrazol-5-yl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 71933978 |
| Molecular Formula | C15H19N3O4 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | N-[1-(2-hydroxyethyl)-3-(2-methylfuran-3-yl)pyrazol-5-yl]oxolane-2-carboxamide |
| SMILES | Cc1occc1-c1cc(NC(=O)C2CCCO2)n(CCO)n1 |
| InChI | InChI=1S/C15H19N3O4/c1-10-11(4-8-21-10)12-9-14(18(17-12)5-6-19)16-15(20)13-3-2-7-22-13/h4,8-9,13,19H,2-3,5-7H2,1H3,(H,16,20) |
| InChIKey | SPXXMBWHSCFCHD-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 89.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |