About 3-bromo-N-(3,5-dimethyl-1,2-oxazol-4-yl)-1-methylindole-2-carboxamide
3-bromo-N-(3,5-dimethyl-1,2-oxazol-4-yl)-1-methylindole-2-carboxamide (PubChem CID 71934822) has the molecular formula C15H14BrN3O2
and a molecular weight of 348.20 g/mol. Its IUPAC name is 3-bromo-N-(3,5-dimethyl-1,2-oxazol-4-yl)-1-methylindole-2-carboxamide.
Molecular Properties
| Compound Name | 3-bromo-N-(3,5-dimethyl-1,2-oxazol-4-yl)-1-methylindole-2-carboxamide |
| PubChem CID | 71934822 |
| Molecular Formula | C15H14BrN3O2 |
| Molecular Weight | 348.20 g/mol |
| Exact Mass | 347.03 |
| IUPAC Name | 3-bromo-N-(3,5-dimethyl-1,2-oxazol-4-yl)-1-methylindole-2-carboxamide |
| SMILES | Cc1noc(C)c1NC(=O)c1c(Br)c2ccccc2n1C |
| InChI | InChI=1S/C15H14BrN3O2/c1-8-13(9(2)21-18-8)17-15(20)14-12(16)10-6-4-5-7-11(10)19(14)3/h4-7H,1-3H3,(H,17,20) |
| InChIKey | JUKWDQQLMJWQQO-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 60.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.20 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-bromo-N-(3,5-dimethyl-1,2-oxazol-4-yl)-1-methylindole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-N-(3,5-dimethyl-1,2-oxazol-4-yl)-1-methylindole-2-carboxamide?
The IUPAC name of 3-bromo-N-(3,5-dimethyl-1,2-oxazol-4-yl)-1-methylindole-2-carboxamide (CID 71934822) is 3-bromo-N-(3,5-dimethyl-1,2-oxazol-4-yl)-1-methylindole-2-carboxamide.
What is the SMILES notation for 3-bromo-N-(3,5-dimethyl-1,2-oxazol-4-yl)-1-methylindole-2-carboxamide?
The canonical SMILES for 3-bromo-N-(3,5-dimethyl-1,2-oxazol-4-yl)-1-methylindole-2-carboxamide is Cc1noc(C)c1NC(=O)c1c(Br)c2ccccc2n1C.
What is the InChIKey of 3-bromo-N-(3,5-dimethyl-1,2-oxazol-4-yl)-1-methylindole-2-carboxamide?
The InChIKey is JUKWDQQLMJWQQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14BrN3O2/c1-8-13(9(2)21-18-8)17-15(20)14-12(16)10-6-4-5-7-11(10)19(14)3/h4-7H,1-3H3,(H,17,20).
What are the key properties of 3-bromo-N-(3,5-dimethyl-1,2-oxazol-4-yl)-1-methylindole-2-carboxamide?
3-bromo-N-(3,5-dimethyl-1,2-oxazol-4-yl)-1-methylindole-2-carboxamide has a molecular weight of 348.20 g/mol, XLogP of 3.80, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-N-(3,5-dimethyl-1,2-oxazol-4-yl)-1-methylindole-2-carboxamide is sourced from PubChem (CID 71934822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).