About (5-phenyl-1,2-oxazol-3-yl)methyl 2-(2-oxo-1,3-dihydroindol-3-yl)acetate
(5-phenyl-1,2-oxazol-3-yl)methyl 2-(2-oxo-1,3-dihydroindol-3-yl)acetate (PubChem CID 71935549) has the molecular formula C20H16N2O4
and a molecular weight of 348.36 g/mol. Its IUPAC name is (5-phenyl-1,2-oxazol-3-yl)methyl 2-(2-oxo-1,3-dihydroindol-3-yl)acetate.
Molecular Properties
| Compound Name | (5-phenyl-1,2-oxazol-3-yl)methyl 2-(2-oxo-1,3-dihydroindol-3-yl)acetate |
| PubChem CID | 71935549 |
| Molecular Formula | C20H16N2O4 |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | (5-phenyl-1,2-oxazol-3-yl)methyl 2-(2-oxo-1,3-dihydroindol-3-yl)acetate |
| SMILES | O=C(CC1C(=O)Nc2ccccc21)OCc1cc(-c2ccccc2)on1 |
| InChI | InChI=1S/C20H16N2O4/c23-19(11-16-15-8-4-5-9-17(15)21-20(16)24)25-12-14-10-18(26-22-14)13-6-2-1-3-7-13/h1-10,16H,11-12H2,(H,21,24) |
| InChIKey | IHCKKRMNSCKQHA-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (5-phenyl-1,2-oxazol-3-yl)methyl 2-(2-oxo-1,3-dihydroindol-3-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-phenyl-1,2-oxazol-3-yl)methyl 2-(2-oxo-1,3-dihydroindol-3-yl)acetate?
The IUPAC name of (5-phenyl-1,2-oxazol-3-yl)methyl 2-(2-oxo-1,3-dihydroindol-3-yl)acetate (CID 71935549) is (5-phenyl-1,2-oxazol-3-yl)methyl 2-(2-oxo-1,3-dihydroindol-3-yl)acetate.
What is the SMILES notation for (5-phenyl-1,2-oxazol-3-yl)methyl 2-(2-oxo-1,3-dihydroindol-3-yl)acetate?
The canonical SMILES for (5-phenyl-1,2-oxazol-3-yl)methyl 2-(2-oxo-1,3-dihydroindol-3-yl)acetate is O=C(CC1C(=O)Nc2ccccc21)OCc1cc(-c2ccccc2)on1.
What is the InChIKey of (5-phenyl-1,2-oxazol-3-yl)methyl 2-(2-oxo-1,3-dihydroindol-3-yl)acetate?
The InChIKey is IHCKKRMNSCKQHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16N2O4/c23-19(11-16-15-8-4-5-9-17(15)21-20(16)24)25-12-14-10-18(26-22-14)13-6-2-1-3-7-13/h1-10,16H,11-12H2,(H,21,24).
What are the key properties of (5-phenyl-1,2-oxazol-3-yl)methyl 2-(2-oxo-1,3-dihydroindol-3-yl)acetate?
(5-phenyl-1,2-oxazol-3-yl)methyl 2-(2-oxo-1,3-dihydroindol-3-yl)acetate has a molecular weight of 348.36 g/mol, XLogP of 3.51, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5-phenyl-1,2-oxazol-3-yl)methyl 2-(2-oxo-1,3-dihydroindol-3-yl)acetate is sourced from PubChem (CID 71935549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).