C13H17NO5S — CID 71935616
N-(3-methoxyphenyl)sulfonyloxane-4-carboxamide (PubChem CID 71935616) has the molecular formula C13H17NO5S and a molecular weight of 299.35 g/mol. Its IUPAC name is N-(3-methoxyphenyl)sulfonyloxane-4-carboxamide.
| Compound Name | N-(3-methoxyphenyl)sulfonyloxane-4-carboxamide |
|---|---|
| PubChem CID | 71935616 |
| Molecular Formula | C13H17NO5S |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | N-(3-methoxyphenyl)sulfonyloxane-4-carboxamide |
| SMILES | COc1cccc(S(=O)(=O)NC(=O)C2CCOCC2)c1 |
| InChI | InChI=1S/C13H17NO5S/c1-18-11-3-2-4-12(9-11)20(16,17)14-13(15)10-5-7-19-8-6-10/h2-4,9-10H,5-8H2,1H3,(H,14,15) |
| InChIKey | PVKYMCKPQUOSNL-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |