C17H16N2O4S — CID 71935789
[4-(cyclopropylmethoxy)phenyl] 5-oxo-2,3-dihydro-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate (PubChem CID 71935789) has the molecular formula C17H16N2O4S and a molecular weight of 344.39 g/mol. Its IUPAC name is [4-(cyclopropylmethoxy)phenyl] 5-oxo-2,3-dihydro-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate.
| Compound Name | [4-(cyclopropylmethoxy)phenyl] 5-oxo-2,3-dihydro-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 71935789 |
| Molecular Formula | C17H16N2O4S |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | [4-(cyclopropylmethoxy)phenyl] 5-oxo-2,3-dihydro-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| SMILES | O=C(Oc1ccc(OCC2CC2)cc1)c1cnc2n(c1=O)CCS2 |
| InChI | InChI=1S/C17H16N2O4S/c20-15-14(9-18-17-19(15)7-8-24-17)16(21)23-13-5-3-12(4-6-13)22-10-11-1-2-11/h3-6,9,11H,1-2,7-8,10H2 |
| InChIKey | ADVQTLXHHLOQAE-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|