About 1-[1-(cyclopentylmethyl)piperidin-4-yl]-3-(1,3-thiazol-2-yl)urea
1-[1-(cyclopentylmethyl)piperidin-4-yl]-3-(1,3-thiazol-2-yl)urea (PubChem CID 71935959) has the molecular formula C15H24N4OS
and a molecular weight of 308.45 g/mol. Its IUPAC name is 1-[1-(cyclopentylmethyl)piperidin-4-yl]-3-(1,3-thiazol-2-yl)urea.
Molecular Properties
| Compound Name | 1-[1-(cyclopentylmethyl)piperidin-4-yl]-3-(1,3-thiazol-2-yl)urea |
| PubChem CID | 71935959 |
| Molecular Formula | C15H24N4OS |
| Molecular Weight | 308.45 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | 1-[1-(cyclopentylmethyl)piperidin-4-yl]-3-(1,3-thiazol-2-yl)urea |
| SMILES | O=C(Nc1nccs1)NC1CCN(CC2CCCC2)CC1 |
| InChI | InChI=1S/C15H24N4OS/c20-14(18-15-16-7-10-21-15)17-13-5-8-19(9-6-13)11-12-3-1-2-4-12/h7,10,12-13H,1-6,8-9,11H2,(H2,16,17,18,20) |
| InChIKey | KAHXLUZETONQBP-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.45 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[1-(cyclopentylmethyl)piperidin-4-yl]-3-(1,3-thiazol-2-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-(cyclopentylmethyl)piperidin-4-yl]-3-(1,3-thiazol-2-yl)urea?
The IUPAC name of 1-[1-(cyclopentylmethyl)piperidin-4-yl]-3-(1,3-thiazol-2-yl)urea (CID 71935959) is 1-[1-(cyclopentylmethyl)piperidin-4-yl]-3-(1,3-thiazol-2-yl)urea.
What is the SMILES notation for 1-[1-(cyclopentylmethyl)piperidin-4-yl]-3-(1,3-thiazol-2-yl)urea?
The canonical SMILES for 1-[1-(cyclopentylmethyl)piperidin-4-yl]-3-(1,3-thiazol-2-yl)urea is O=C(Nc1nccs1)NC1CCN(CC2CCCC2)CC1.
What is the InChIKey of 1-[1-(cyclopentylmethyl)piperidin-4-yl]-3-(1,3-thiazol-2-yl)urea?
The InChIKey is KAHXLUZETONQBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24N4OS/c20-14(18-15-16-7-10-21-15)17-13-5-8-19(9-6-13)11-12-3-1-2-4-12/h7,10,12-13H,1-6,8-9,11H2,(H2,16,17,18,20).
What are the key properties of 1-[1-(cyclopentylmethyl)piperidin-4-yl]-3-(1,3-thiazol-2-yl)urea?
1-[1-(cyclopentylmethyl)piperidin-4-yl]-3-(1,3-thiazol-2-yl)urea has a molecular weight of 308.45 g/mol, XLogP of 2.92, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-(cyclopentylmethyl)piperidin-4-yl]-3-(1,3-thiazol-2-yl)urea is sourced from PubChem (CID 71935959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).