About N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-4-methylazepane-1-carboxamide
N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-4-methylazepane-1-carboxamide (PubChem CID 71935964) has the molecular formula C14H23N3O2
and a molecular weight of 265.36 g/mol. Its IUPAC name is N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-4-methylazepane-1-carboxamide.
Molecular Properties
| Compound Name | N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-4-methylazepane-1-carboxamide |
| PubChem CID | 71935964 |
| Molecular Formula | C14H23N3O2 |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-4-methylazepane-1-carboxamide |
| SMILES | Cc1noc(C)c1CNC(=O)N1CCCC(C)CC1 |
| InChI | InChI=1S/C14H23N3O2/c1-10-5-4-7-17(8-6-10)14(18)15-9-13-11(2)16-19-12(13)3/h10H,4-9H2,1-3H3,(H,15,18) |
| InChIKey | SHUPKTGQHOVRMM-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-4-methylazepane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-4-methylazepane-1-carboxamide?
The IUPAC name of N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-4-methylazepane-1-carboxamide (CID 71935964) is N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-4-methylazepane-1-carboxamide.
What is the SMILES notation for N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-4-methylazepane-1-carboxamide?
The canonical SMILES for N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-4-methylazepane-1-carboxamide is Cc1noc(C)c1CNC(=O)N1CCCC(C)CC1.
What is the InChIKey of N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-4-methylazepane-1-carboxamide?
The InChIKey is SHUPKTGQHOVRMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23N3O2/c1-10-5-4-7-17(8-6-10)14(18)15-9-13-11(2)16-19-12(13)3/h10H,4-9H2,1-3H3,(H,15,18).
What are the key properties of N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-4-methylazepane-1-carboxamide?
N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-4-methylazepane-1-carboxamide has a molecular weight of 265.36 g/mol, XLogP of 2.62, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-4-methylazepane-1-carboxamide is sourced from PubChem (CID 71935964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).