C20H29N3O3 — CID 71935966
N-[2-methoxy-5-(pyrrolidine-1-carbonyl)phenyl]azocane-1-carboxamide (PubChem CID 71935966) has the molecular formula C20H29N3O3 and a molecular weight of 359.47 g/mol. Its IUPAC name is N-[2-methoxy-5-(pyrrolidine-1-carbonyl)phenyl]azocane-1-carboxamide.
| Compound Name | N-[2-methoxy-5-(pyrrolidine-1-carbonyl)phenyl]azocane-1-carboxamide |
|---|---|
| PubChem CID | 71935966 |
| Molecular Formula | C20H29N3O3 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.22 |
| IUPAC Name | N-[2-methoxy-5-(pyrrolidine-1-carbonyl)phenyl]azocane-1-carboxamide |
| SMILES | COc1ccc(C(=O)N2CCCC2)cc1NC(=O)N1CCCCCCC1 |
| InChI | InChI=1S/C20H29N3O3/c1-26-18-10-9-16(19(24)22-11-7-8-12-22)15-17(18)21-20(25)23-13-5-3-2-4-6-14-23/h9-10,15H,2-8,11-14H2,1H3,(H,21,25) |
| InChIKey | GEROFOXHBXYQJO-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |