C13H19N3O3 — CID 71937200
3-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-5,5-diethylimidazolidine-2,4-dione (PubChem CID 71937200) has the molecular formula C13H19N3O3 and a molecular weight of 265.31 g/mol. Its IUPAC name is 3-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-5,5-diethylimidazolidine-2,4-dione.
| Compound Name | 3-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-5,5-diethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 71937200 |
| Molecular Formula | C13H19N3O3 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.14 |
| IUPAC Name | 3-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-5,5-diethylimidazolidine-2,4-dione |
| SMILES | CCC1(CC)NC(=O)N(Cc2nc(C)c(C)o2)C1=O |
| InChI | InChI=1S/C13H19N3O3/c1-5-13(6-2)11(17)16(12(18)15-13)7-10-14-8(3)9(4)19-10/h5-7H2,1-4H3,(H,15,18) |
| InChIKey | GVEMRJBHPXOZQE-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|