About 2-phenyl-N-(1H-1,2,4-triazol-5-ylmethyl)benzamide
2-phenyl-N-(1H-1,2,4-triazol-5-ylmethyl)benzamide (PubChem CID 71937205) has the molecular formula C16H14N4O
and a molecular weight of 278.31 g/mol. Its IUPAC name is 2-phenyl-N-(1H-1,2,4-triazol-5-ylmethyl)benzamide.
Molecular Properties
| Compound Name | 2-phenyl-N-(1H-1,2,4-triazol-5-ylmethyl)benzamide |
| PubChem CID | 71937205 |
| Molecular Formula | C16H14N4O |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | 2-phenyl-N-(1H-1,2,4-triazol-5-ylmethyl)benzamide |
| SMILES | O=C(NCc1ncn[nH]1)c1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C16H14N4O/c21-16(17-10-15-18-11-19-20-15)14-9-5-4-8-13(14)12-6-2-1-3-7-12/h1-9,11H,10H2,(H,17,21)(H,18,19,20) |
| InChIKey | NBIVYOIDFNGLJJ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-phenyl-N-(1H-1,2,4-triazol-5-ylmethyl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenyl-N-(1H-1,2,4-triazol-5-ylmethyl)benzamide?
The IUPAC name of 2-phenyl-N-(1H-1,2,4-triazol-5-ylmethyl)benzamide (CID 71937205) is 2-phenyl-N-(1H-1,2,4-triazol-5-ylmethyl)benzamide.
What is the SMILES notation for 2-phenyl-N-(1H-1,2,4-triazol-5-ylmethyl)benzamide?
The canonical SMILES for 2-phenyl-N-(1H-1,2,4-triazol-5-ylmethyl)benzamide is O=C(NCc1ncn[nH]1)c1ccccc1-c1ccccc1.
What is the InChIKey of 2-phenyl-N-(1H-1,2,4-triazol-5-ylmethyl)benzamide?
The InChIKey is NBIVYOIDFNGLJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14N4O/c21-16(17-10-15-18-11-19-20-15)14-9-5-4-8-13(14)12-6-2-1-3-7-12/h1-9,11H,10H2,(H,17,21)(H,18,19,20).
What are the key properties of 2-phenyl-N-(1H-1,2,4-triazol-5-ylmethyl)benzamide?
2-phenyl-N-(1H-1,2,4-triazol-5-ylmethyl)benzamide has a molecular weight of 278.31 g/mol, XLogP of 2.40, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenyl-N-(1H-1,2,4-triazol-5-ylmethyl)benzamide is sourced from PubChem (CID 71937205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).