C11H17N3O2S — CID 71937221
3-[3-(1-ethylimidazol-2-yl)sulfanylpropyl]-1,3-oxazolidin-2-one (PubChem CID 71937221) has the molecular formula C11H17N3O2S and a molecular weight of 255.34 g/mol. Its IUPAC name is 3-[3-(1-ethylimidazol-2-yl)sulfanylpropyl]-1,3-oxazolidin-2-one.
| Compound Name | 3-[3-(1-ethylimidazol-2-yl)sulfanylpropyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 71937221 |
| Molecular Formula | C11H17N3O2S |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | 3-[3-(1-ethylimidazol-2-yl)sulfanylpropyl]-1,3-oxazolidin-2-one |
| SMILES | CCn1ccnc1SCCCN1CCOC1=O |
| InChI | InChI=1S/C11H17N3O2S/c1-2-13-6-4-12-10(13)17-9-3-5-14-7-8-16-11(14)15/h4,6H,2-3,5,7-9H2,1H3 |
| InChIKey | YACHQUZCSDRMOG-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|