About 1-[[4-(1,3-oxazol-5-yl)benzoyl]amino]cyclohexane-1-carboxylic acid
1-[[4-(1,3-oxazol-5-yl)benzoyl]amino]cyclohexane-1-carboxylic acid (PubChem CID 71938400) has the molecular formula C17H18N2O4
and a molecular weight of 314.34 g/mol. Its IUPAC name is 1-[[4-(1,3-oxazol-5-yl)benzoyl]amino]cyclohexane-1-carboxylic acid.
Molecular Properties
| Compound Name | 1-[[4-(1,3-oxazol-5-yl)benzoyl]amino]cyclohexane-1-carboxylic acid |
| PubChem CID | 71938400 |
| Molecular Formula | C17H18N2O4 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | 1-[[4-(1,3-oxazol-5-yl)benzoyl]amino]cyclohexane-1-carboxylic acid |
| SMILES | O=C(NC1(C(=O)O)CCCCC1)c1ccc(-c2cnco2)cc1 |
| InChI | InChI=1S/C17H18N2O4/c20-15(19-17(16(21)22)8-2-1-3-9-17)13-6-4-12(5-7-13)14-10-18-11-23-14/h4-7,10-11H,1-3,8-9H2,(H,19,20)(H,21,22) |
| InChIKey | YZWIJPLVMWKQPI-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[[4-(1,3-oxazol-5-yl)benzoyl]amino]cyclohexane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[4-(1,3-oxazol-5-yl)benzoyl]amino]cyclohexane-1-carboxylic acid?
The IUPAC name of 1-[[4-(1,3-oxazol-5-yl)benzoyl]amino]cyclohexane-1-carboxylic acid (CID 71938400) is 1-[[4-(1,3-oxazol-5-yl)benzoyl]amino]cyclohexane-1-carboxylic acid.
What is the SMILES notation for 1-[[4-(1,3-oxazol-5-yl)benzoyl]amino]cyclohexane-1-carboxylic acid?
The canonical SMILES for 1-[[4-(1,3-oxazol-5-yl)benzoyl]amino]cyclohexane-1-carboxylic acid is O=C(NC1(C(=O)O)CCCCC1)c1ccc(-c2cnco2)cc1.
What is the InChIKey of 1-[[4-(1,3-oxazol-5-yl)benzoyl]amino]cyclohexane-1-carboxylic acid?
The InChIKey is YZWIJPLVMWKQPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18N2O4/c20-15(19-17(16(21)22)8-2-1-3-9-17)13-6-4-12(5-7-13)14-10-18-11-23-14/h4-7,10-11H,1-3,8-9H2,(H,19,20)(H,21,22).
What are the key properties of 1-[[4-(1,3-oxazol-5-yl)benzoyl]amino]cyclohexane-1-carboxylic acid?
1-[[4-(1,3-oxazol-5-yl)benzoyl]amino]cyclohexane-1-carboxylic acid has a molecular weight of 314.34 g/mol, XLogP of 2.86, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[4-(1,3-oxazol-5-yl)benzoyl]amino]cyclohexane-1-carboxylic acid is sourced from PubChem (CID 71938400), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).