C21H20F4N2O3 — CID 71939910
N-[1-(2-fluorobenzoyl)piperidin-4-yl]-2-[4-(trifluoromethyl)phenoxy]acetamide (PubChem CID 71939910) has the molecular formula C21H20F4N2O3 and a molecular weight of 424.39 g/mol. Its IUPAC name is N-[1-(2-fluorobenzoyl)piperidin-4-yl]-2-[4-(trifluoromethyl)phenoxy]acetamide.
| Compound Name | N-[1-(2-fluorobenzoyl)piperidin-4-yl]-2-[4-(trifluoromethyl)phenoxy]acetamide |
|---|---|
| PubChem CID | 71939910 |
| Molecular Formula | C21H20F4N2O3 |
| Molecular Weight | 424.39 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | N-[1-(2-fluorobenzoyl)piperidin-4-yl]-2-[4-(trifluoromethyl)phenoxy]acetamide |
| SMILES | O=C(COc1ccc(C(F)(F)F)cc1)NC1CCN(C(=O)c2ccccc2F)CC1 |
| InChI | InChI=1S/C21H20F4N2O3/c22-18-4-2-1-3-17(18)20(29)27-11-9-15(10-12-27)26-19(28)13-30-16-7-5-14(6-8-16)21(23,24)25/h1-8,15H,9-13H2,(H,26,28) |
| InChIKey | RSANKBCJFKHZLS-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.39 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |