C14H17F3N2O3 — CID 71940364
N-[1-oxo-1-[3-(trifluoromethyl)piperidin-1-yl]propan-2-yl]furan-3-carboxamide (PubChem CID 71940364) has the molecular formula C14H17F3N2O3 and a molecular weight of 318.30 g/mol. Its IUPAC name is N-[1-oxo-1-[3-(trifluoromethyl)piperidin-1-yl]propan-2-yl]furan-3-carboxamide.
| Compound Name | N-[1-oxo-1-[3-(trifluoromethyl)piperidin-1-yl]propan-2-yl]furan-3-carboxamide |
|---|---|
| PubChem CID | 71940364 |
| Molecular Formula | C14H17F3N2O3 |
| Molecular Weight | 318.30 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | N-[1-oxo-1-[3-(trifluoromethyl)piperidin-1-yl]propan-2-yl]furan-3-carboxamide |
| SMILES | CC(NC(=O)c1ccoc1)C(=O)N1CCCC(C(F)(F)F)C1 |
| InChI | InChI=1S/C14H17F3N2O3/c1-9(18-12(20)10-4-6-22-8-10)13(21)19-5-2-3-11(7-19)14(15,16)17/h4,6,8-9,11H,2-3,5,7H2,1H3,(H,18,20) |
| InChIKey | SCOYIRCLWZQCJC-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.30 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |