C17H25N3O2 — CID 71941250
N-[2-(2-bicyclo[2.2.1]heptanyl)ethyl]-2-oxo-2-(1,3,5-trimethylpyrazol-4-yl)acetamide (PubChem CID 71941250) has the molecular formula C17H25N3O2 and a molecular weight of 303.41 g/mol. Its IUPAC name is N-[2-(2-bicyclo[2.2.1]heptanyl)ethyl]-2-oxo-2-(1,3,5-trimethylpyrazol-4-yl)acetamide.
| Compound Name | N-[2-(2-bicyclo[2.2.1]heptanyl)ethyl]-2-oxo-2-(1,3,5-trimethylpyrazol-4-yl)acetamide |
|---|---|
| PubChem CID | 71941250 |
| Molecular Formula | C17H25N3O2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | N-[2-(2-bicyclo[2.2.1]heptanyl)ethyl]-2-oxo-2-(1,3,5-trimethylpyrazol-4-yl)acetamide |
| SMILES | Cc1nn(C)c(C)c1C(=O)C(=O)NCCC1CC2CCC1C2 |
| InChI | InChI=1S/C17H25N3O2/c1-10-15(11(2)20(3)19-10)16(21)17(22)18-7-6-14-9-12-4-5-13(14)8-12/h12-14H,4-9H2,1-3H3,(H,18,22) |
| InChIKey | MQPJSPSZOQSCLQ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|