C16H18F3N3O2 — CID 71942657
N-(3,5-dimethyl-1-phenylpyrazol-4-yl)-3-(2,2,2-trifluoroethoxy)propanamide (PubChem CID 71942657) has the molecular formula C16H18F3N3O2 and a molecular weight of 341.33 g/mol. Its IUPAC name is N-(3,5-dimethyl-1-phenylpyrazol-4-yl)-3-(2,2,2-trifluoroethoxy)propanamide.
| Compound Name | N-(3,5-dimethyl-1-phenylpyrazol-4-yl)-3-(2,2,2-trifluoroethoxy)propanamide |
|---|---|
| PubChem CID | 71942657 |
| Molecular Formula | C16H18F3N3O2 |
| Molecular Weight | 341.33 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | N-(3,5-dimethyl-1-phenylpyrazol-4-yl)-3-(2,2,2-trifluoroethoxy)propanamide |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1NC(=O)CCOCC(F)(F)F |
| InChI | InChI=1S/C16H18F3N3O2/c1-11-15(20-14(23)8-9-24-10-16(17,18)19)12(2)22(21-11)13-6-4-3-5-7-13/h3-7H,8-10H2,1-2H3,(H,20,23) |
| InChIKey | ZSNJKGPGIYYEAQ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.33 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|