C15H17F3N2O4 — CID 71942702
1-[[2-[2-oxo-3-(trifluoromethyl)-1-pyridinyl]acetyl]amino]cyclohexane-1-carboxylic acid (PubChem CID 71942702) has the molecular formula C15H17F3N2O4 and a molecular weight of 346.31 g/mol. Its IUPAC name is 1-[[2-[2-oxo-3-(trifluoromethyl)-1-pyridinyl]acetyl]amino]cyclohexane-1-carboxylic acid.
| Compound Name | 1-[[2-[2-oxo-3-(trifluoromethyl)-1-pyridinyl]acetyl]amino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 71942702 |
| Molecular Formula | C15H17F3N2O4 |
| Molecular Weight | 346.31 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | 1-[[2-[2-oxo-3-(trifluoromethyl)-1-pyridinyl]acetyl]amino]cyclohexane-1-carboxylic acid |
| SMILES | O=C(Cn1cccc(C(F)(F)F)c1=O)NC1(C(=O)O)CCCCC1 |
| InChI | InChI=1S/C15H17F3N2O4/c16-15(17,18)10-5-4-8-20(12(10)22)9-11(21)19-14(13(23)24)6-2-1-3-7-14/h4-5,8H,1-3,6-7,9H2,(H,19,21)(H,23,24) |
| InChIKey | JLCHOVYKSXPLKA-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 88.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.31 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |