C16H19N3O4 — CID 71942758
[2-(azepan-1-yl)-2-oxoethyl] 3-(furan-2-yl)-1H-pyrazole-5-carboxylate (PubChem CID 71942758) has the molecular formula C16H19N3O4 and a molecular weight of 317.34 g/mol. Its IUPAC name is [2-(azepan-1-yl)-2-oxoethyl] 3-(furan-2-yl)-1H-pyrazole-5-carboxylate.
| Compound Name | [2-(azepan-1-yl)-2-oxoethyl] 3-(furan-2-yl)-1H-pyrazole-5-carboxylate |
|---|---|
| PubChem CID | 71942758 |
| Molecular Formula | C16H19N3O4 |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | [2-(azepan-1-yl)-2-oxoethyl] 3-(furan-2-yl)-1H-pyrazole-5-carboxylate |
| SMILES | O=C(OCC(=O)N1CCCCCC1)c1cc(-c2ccco2)n[nH]1 |
| InChI | InChI=1S/C16H19N3O4/c20-15(19-7-3-1-2-4-8-19)11-23-16(21)13-10-12(17-18-13)14-6-5-9-22-14/h5-6,9-10H,1-4,7-8,11H2,(H,17,18) |
| InChIKey | WHFRLBASQIOJSF-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 88.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |