C23H28N4O4 — CID 71944686
N-[2-[methyl-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]amino]-2-oxoethyl]-2-phenylacetamide (PubChem CID 71944686) has the molecular formula C23H28N4O4 and a molecular weight of 424.50 g/mol. Its IUPAC name is N-[2-[methyl-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]amino]-2-oxoethyl]-2-phenylacetamide.
| Compound Name | N-[2-[methyl-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]amino]-2-oxoethyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 71944686 |
| Molecular Formula | C23H28N4O4 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | N-[2-[methyl-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]amino]-2-oxoethyl]-2-phenylacetamide |
| SMILES | CN(CC(=O)Nc1ccc(N2CCOCC2)cc1)C(=O)CNC(=O)Cc1ccccc1 |
| InChI | InChI=1S/C23H28N4O4/c1-26(23(30)16-24-21(28)15-18-5-3-2-4-6-18)17-22(29)25-19-7-9-20(10-8-19)27-11-13-31-14-12-27/h2-10H,11-17H2,1H3,(H,24,28)(H,25,29) |
| InChIKey | XPTAOBHZLBPTGP-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|