C13H15N3O3S — CID 71946087
N-[5-[2-(4-methoxyphenoxy)ethyl]-1,3,4-thiadiazol-2-yl]acetamide (PubChem CID 71946087) has the molecular formula C13H15N3O3S and a molecular weight of 293.35 g/mol. Its IUPAC name is N-[5-[2-(4-methoxyphenoxy)ethyl]-1,3,4-thiadiazol-2-yl]acetamide.
| Compound Name | N-[5-[2-(4-methoxyphenoxy)ethyl]-1,3,4-thiadiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 71946087 |
| Molecular Formula | C13H15N3O3S |
| Molecular Weight | 293.35 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | N-[5-[2-(4-methoxyphenoxy)ethyl]-1,3,4-thiadiazol-2-yl]acetamide |
| SMILES | COc1ccc(OCCc2nnc(NC(C)=O)s2)cc1 |
| InChI | InChI=1S/C13H15N3O3S/c1-9(17)14-13-16-15-12(20-13)7-8-19-11-5-3-10(18-2)4-6-11/h3-6H,7-8H2,1-2H3,(H,14,16,17) |
| InChIKey | KMXSPEGYVNGUAO-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.35 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |