C13H23Cl2N3O — CID 71947269
1-[1-(azepan-1-yl)-2,2-dichloroethylidene]-3-tert-butylurea (PubChem CID 71947269) has the molecular formula C13H23Cl2N3O and a molecular weight of 308.25 g/mol. Its IUPAC name is 1-[1-(azepan-1-yl)-2,2-dichloroethylidene]-3-tert-butylurea.
| Compound Name | 1-[1-(azepan-1-yl)-2,2-dichloroethylidene]-3-tert-butylurea |
|---|---|
| PubChem CID | 71947269 |
| Molecular Formula | C13H23Cl2N3O |
| Molecular Weight | 308.25 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | 1-[1-(azepan-1-yl)-2,2-dichloroethylidene]-3-tert-butylurea |
| SMILES | CC(C)(C)NC(=O)N=C(C(Cl)Cl)N1CCCCCC1 |
| InChI | InChI=1S/C13H23Cl2N3O/c1-13(2,3)17-12(19)16-11(10(14)15)18-8-6-4-5-7-9-18/h10H,4-9H2,1-3H3,(H,17,19) |
| InChIKey | CNAHSBJGXGVXSK-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.25 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|