C22H23NO6S — CID 71948436
methyl 3-[5-[(8-acetyl-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]-2-methoxyphenyl]prop-2-enoate (PubChem CID 71948436) has the molecular formula C22H23NO6S and a molecular weight of 429.49 g/mol. Its IUPAC name is methyl 3-[5-[(8-acetyl-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]-2-methoxyphenyl]prop-2-enoate.
| Compound Name | methyl 3-[5-[(8-acetyl-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]-2-methoxyphenyl]prop-2-enoate |
|---|---|
| PubChem CID | 71948436 |
| Molecular Formula | C22H23NO6S |
| Molecular Weight | 429.49 g/mol |
| Exact Mass | 429.12 |
| IUPAC Name | methyl 3-[5-[(8-acetyl-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]-2-methoxyphenyl]prop-2-enoate |
| SMILES | COC(=O)C=Cc1cc(S(=O)(=O)N2CCCc3cccc(C(C)=O)c32)ccc1OC |
| InChI | InChI=1S/C22H23NO6S/c1-15(24)19-8-4-6-16-7-5-13-23(22(16)19)30(26,27)18-10-11-20(28-2)17(14-18)9-12-21(25)29-3/h4,6,8-12,14H,5,7,13H2,1-3H3 |
| InChIKey | RXYADQSHKXKSHZ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.49 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|