C22H23N7 — CID 71948590
2,4-diamino-6-[1-cyano-2-[4-[methyl(3-methylbutyl)amino]phenyl]ethenyl]pyridine-3,5-dicarbonitrile (PubChem CID 71948590) has the molecular formula C22H23N7 and a molecular weight of 385.48 g/mol. Its IUPAC name is 2,4-diamino-6-[1-cyano-2-[4-[methyl(3-methylbutyl)amino]phenyl]ethenyl]pyridine-3,5-dicarbonitrile.
| Compound Name | 2,4-diamino-6-[1-cyano-2-[4-[methyl(3-methylbutyl)amino]phenyl]ethenyl]pyridine-3,5-dicarbonitrile |
|---|---|
| PubChem CID | 71948590 |
| Molecular Formula | C22H23N7 |
| Molecular Weight | 385.48 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | 2,4-diamino-6-[1-cyano-2-[4-[methyl(3-methylbutyl)amino]phenyl]ethenyl]pyridine-3,5-dicarbonitrile |
| SMILES | CC(C)CCN(C)c1ccc(C=C(C#N)c2nc(N)c(C#N)c(N)c2C#N)cc1 |
| InChI | InChI=1S/C22H23N7/c1-14(2)8-9-29(3)17-6-4-15(5-7-17)10-16(11-23)21-18(12-24)20(26)19(13-25)22(27)28-21/h4-7,10,14H,8-9H2,1-3H3,(H4,26,27,28) |
| InChIKey | OCDJXVLXHJKBNZ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 139.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.48 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|