C20H25N2O3S+ — CID 7195031
N-[5-ethyl-3-(4-methoxybenzoyl)thiophen-2-yl]-2-pyrrolidin-1-ium-1-ylacetamide (PubChem CID 7195031) has the molecular formula C20H25N2O3S+ and a molecular weight of 373.50 g/mol. Its IUPAC name is N-[5-ethyl-3-(4-methoxybenzoyl)thiophen-2-yl]-2-pyrrolidin-1-ium-1-ylacetamide.
| Compound Name | N-[5-ethyl-3-(4-methoxybenzoyl)thiophen-2-yl]-2-pyrrolidin-1-ium-1-ylacetamide |
|---|---|
| PubChem CID | 7195031 |
| Molecular Formula | C20H25N2O3S+ |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | N-[5-ethyl-3-(4-methoxybenzoyl)thiophen-2-yl]-2-pyrrolidin-1-ium-1-ylacetamide |
| SMILES | CCc1cc(C(=O)c2ccc(OC)cc2)c(NC(=O)C[NH+]2CCCC2)s1 |
| InChI | InChI=1S/C20H24N2O3S/c1-3-16-12-17(19(24)14-6-8-15(25-2)9-7-14)20(26-16)21-18(23)13-22-10-4-5-11-22/h6-9,12H,3-5,10-11,13H2,1-2H3,(H,21,23)/p+1 |
| InChIKey | RQPQUPSPHCUYTK-UHFFFAOYSA-O |
| XLogP | 2.17 |
| TPSA | 59.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |