C16H12Cl2N4O2 — CID 71951607
N-[[5-(3,5-dichlorophenyl)furan-2-yl]methylideneamino]-5-methyl-1H-pyrazole-3-carboxamide (PubChem CID 71951607) has the molecular formula C16H12Cl2N4O2 and a molecular weight of 363.20 g/mol. Its IUPAC name is N-[[5-(3,5-dichlorophenyl)furan-2-yl]methylideneamino]-5-methyl-1H-pyrazole-3-carboxamide.
| Compound Name | N-[[5-(3,5-dichlorophenyl)furan-2-yl]methylideneamino]-5-methyl-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 71951607 |
| Molecular Formula | C16H12Cl2N4O2 |
| Molecular Weight | 363.20 g/mol |
| Exact Mass | 362.03 |
| IUPAC Name | N-[[5-(3,5-dichlorophenyl)furan-2-yl]methylideneamino]-5-methyl-1H-pyrazole-3-carboxamide |
| SMILES | Cc1cc(C(=O)NN=Cc2ccc(-c3cc(Cl)cc(Cl)c3)o2)n[nH]1 |
| InChI | InChI=1S/C16H12Cl2N4O2/c1-9-4-14(21-20-9)16(23)22-19-8-13-2-3-15(24-13)10-5-11(17)7-12(18)6-10/h2-8H,1H3,(H,20,21)(H,22,23) |
| InChIKey | LRTYUEHWKDAYMZ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 83.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.20 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|