C15H12Cl2N2O — CID 71952071
2-chloro-N-[(3-chlorophenyl)methylideneamino]-4-methylbenzamide (PubChem CID 71952071) has the molecular formula C15H12Cl2N2O and a molecular weight of 307.18 g/mol. Its IUPAC name is 2-chloro-N-[(3-chlorophenyl)methylideneamino]-4-methylbenzamide.
| Compound Name | 2-chloro-N-[(3-chlorophenyl)methylideneamino]-4-methylbenzamide |
|---|---|
| PubChem CID | 71952071 |
| Molecular Formula | C15H12Cl2N2O |
| Molecular Weight | 307.18 g/mol |
| Exact Mass | 306.03 |
| IUPAC Name | 2-chloro-N-[(3-chlorophenyl)methylideneamino]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)NN=Cc2cccc(Cl)c2)c(Cl)c1 |
| InChI | InChI=1S/C15H12Cl2N2O/c1-10-5-6-13(14(17)7-10)15(20)19-18-9-11-3-2-4-12(16)8-11/h2-9H,1H3,(H,19,20) |
| InChIKey | VSXXSCGKGIDZHD-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.18 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|