C21H17ClN2O6 — CID 71952291
[4-[[[2-(3-chlorophenoxy)acetyl]hydrazinylidene]methyl]-2-methoxyphenyl] furan-2-carboxylate (PubChem CID 71952291) has the molecular formula C21H17ClN2O6 and a molecular weight of 428.83 g/mol. Its IUPAC name is [4-[[[2-(3-chlorophenoxy)acetyl]hydrazinylidene]methyl]-2-methoxyphenyl] furan-2-carboxylate.
| Compound Name | [4-[[[2-(3-chlorophenoxy)acetyl]hydrazinylidene]methyl]-2-methoxyphenyl] furan-2-carboxylate |
|---|---|
| PubChem CID | 71952291 |
| Molecular Formula | C21H17ClN2O6 |
| Molecular Weight | 428.83 g/mol |
| Exact Mass | 428.08 |
| IUPAC Name | [4-[[[2-(3-chlorophenoxy)acetyl]hydrazinylidene]methyl]-2-methoxyphenyl] furan-2-carboxylate |
| SMILES | COc1cc(C=NNC(=O)COc2cccc(Cl)c2)ccc1OC(=O)c1ccco1 |
| InChI | InChI=1S/C21H17ClN2O6/c1-27-19-10-14(7-8-17(19)30-21(26)18-6-3-9-28-18)12-23-24-20(25)13-29-16-5-2-4-15(22)11-16/h2-12H,13H2,1H3,(H,24,25) |
| InChIKey | QOLYKFJVKZINCB-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 99.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.83 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|