C24H17N3O3 — CID 7195257
2-[[5-[(5S)-5,6-dihydropyrrolo[1,2-c]quinazolin-5-yl]furan-2-yl]methyl]isoindole-1,3-dione (PubChem CID 7195257) has the molecular formula C24H17N3O3 and a molecular weight of 395.42 g/mol. Its IUPAC name is 2-[[5-[(5S)-5,6-dihydropyrrolo[1,2-c]quinazolin-5-yl]furan-2-yl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[5-[(5S)-5,6-dihydropyrrolo[1,2-c]quinazolin-5-yl]furan-2-yl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 7195257 |
| Molecular Formula | C24H17N3O3 |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | 2-[[5-[(5S)-5,6-dihydropyrrolo[1,2-c]quinazolin-5-yl]furan-2-yl]methyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1Cc1ccc([C@H]2Nc3ccccc3-c3cccn32)o1 |
| InChI | InChI=1S/C24H17N3O3/c28-23-16-6-1-2-7-17(16)24(29)27(23)14-15-11-12-21(30-15)22-25-19-9-4-3-8-18(19)20-10-5-13-26(20)22/h1-13,22,25H,14H2/t22-/m0/s1 |
| InChIKey | DXUFXJCFQKZEDI-QFIPXVFZSA-N |
| XLogP | 4.52 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|