C22H25N3S2 — CID 7195298
(3S,3aR)-N-cyclohexyl-3-thiophen-2-yl-3,3a,4,5-tetrahydrobenzo[g]indazole-2-carbothioamide (PubChem CID 7195298) has the molecular formula C22H25N3S2 and a molecular weight of 395.60 g/mol. Its IUPAC name is (3S,3aR)-N-cyclohexyl-3-thiophen-2-yl-3,3a,4,5-tetrahydrobenzo[g]indazole-2-carbothioamide.
| Compound Name | (3S,3aR)-N-cyclohexyl-3-thiophen-2-yl-3,3a,4,5-tetrahydrobenzo[g]indazole-2-carbothioamide |
|---|---|
| PubChem CID | 7195298 |
| Molecular Formula | C22H25N3S2 |
| Molecular Weight | 395.60 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | (3S,3aR)-N-cyclohexyl-3-thiophen-2-yl-3,3a,4,5-tetrahydrobenzo[g]indazole-2-carbothioamide |
| SMILES | S=C(NC1CCCCC1)N1N=C2c3ccccc3CC[C@@H]2[C@H]1c1cccs1 |
| InChI | InChI=1S/C22H25N3S2/c26-22(23-16-8-2-1-3-9-16)25-21(19-11-6-14-27-19)18-13-12-15-7-4-5-10-17(15)20(18)24-25/h4-7,10-11,14,16,18,21H,1-3,8-9,12-13H2,(H,23,26)/t18-,21-/m0/s1 |
| InChIKey | QCJXVHCVRQZOHK-RXVVDRJESA-N |
| XLogP | 5.28 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.60 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|