C26H27N3O5S — CID 71953049
[2-[2-(2-methylanilino)-2-oxoethyl]-1,3-thiazol-4-yl]methyl 2-[3-(4-methoxyphenyl)prop-2-enoylamino]propanoate (PubChem CID 71953049) has the molecular formula C26H27N3O5S and a molecular weight of 493.59 g/mol. Its IUPAC name is [2-[2-(2-methylanilino)-2-oxoethyl]-1,3-thiazol-4-yl]methyl 2-[3-(4-methoxyphenyl)prop-2-enoylamino]propanoate.
| Compound Name | [2-[2-(2-methylanilino)-2-oxoethyl]-1,3-thiazol-4-yl]methyl 2-[3-(4-methoxyphenyl)prop-2-enoylamino]propanoate |
|---|---|
| PubChem CID | 71953049 |
| Molecular Formula | C26H27N3O5S |
| Molecular Weight | 493.59 g/mol |
| Exact Mass | 493.17 |
| IUPAC Name | [2-[2-(2-methylanilino)-2-oxoethyl]-1,3-thiazol-4-yl]methyl 2-[3-(4-methoxyphenyl)prop-2-enoylamino]propanoate |
| SMILES | COc1ccc(C=CC(=O)NC(C)C(=O)OCc2csc(CC(=O)Nc3ccccc3C)n2)cc1 |
| InChI | InChI=1S/C26H27N3O5S/c1-17-6-4-5-7-22(17)29-24(31)14-25-28-20(16-35-25)15-34-26(32)18(2)27-23(30)13-10-19-8-11-21(33-3)12-9-19/h4-13,16,18H,14-15H2,1-3H3,(H,27,30)(H,29,31) |
| InChIKey | ZJNFZVAJAGBHOH-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 106.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.59 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|