About [2-(4-fluorophenyl)-1,3-thiazol-4-yl]methyl 3-quinolin-2-ylprop-2-enoate
[2-(4-fluorophenyl)-1,3-thiazol-4-yl]methyl 3-quinolin-2-ylprop-2-enoate (PubChem CID 71953116) has the molecular formula C22H15FN2O2S
and a molecular weight of 390.44 g/mol. Its IUPAC name is [2-(4-fluorophenyl)-1,3-thiazol-4-yl]methyl 3-quinolin-2-ylprop-2-enoate.
Molecular Properties
| Compound Name | [2-(4-fluorophenyl)-1,3-thiazol-4-yl]methyl 3-quinolin-2-ylprop-2-enoate |
| PubChem CID | 71953116 |
| Molecular Formula | C22H15FN2O2S |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.08 |
| IUPAC Name | [2-(4-fluorophenyl)-1,3-thiazol-4-yl]methyl 3-quinolin-2-ylprop-2-enoate |
| SMILES | O=C(C=Cc1ccc2ccccc2n1)OCc1csc(-c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C22H15FN2O2S/c23-17-8-5-16(6-9-17)22-25-19(14-28-22)13-27-21(26)12-11-18-10-7-15-3-1-2-4-20(15)24-18/h1-12,14H,13H2 |
| InChIKey | JJZSASXACJLCEB-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [2-(4-fluorophenyl)-1,3-thiazol-4-yl]methyl 3-quinolin-2-ylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(4-fluorophenyl)-1,3-thiazol-4-yl]methyl 3-quinolin-2-ylprop-2-enoate?
The IUPAC name of [2-(4-fluorophenyl)-1,3-thiazol-4-yl]methyl 3-quinolin-2-ylprop-2-enoate (CID 71953116) is [2-(4-fluorophenyl)-1,3-thiazol-4-yl]methyl 3-quinolin-2-ylprop-2-enoate.
What is the SMILES notation for [2-(4-fluorophenyl)-1,3-thiazol-4-yl]methyl 3-quinolin-2-ylprop-2-enoate?
The canonical SMILES for [2-(4-fluorophenyl)-1,3-thiazol-4-yl]methyl 3-quinolin-2-ylprop-2-enoate is O=C(C=Cc1ccc2ccccc2n1)OCc1csc(-c2ccc(F)cc2)n1.
What is the InChIKey of [2-(4-fluorophenyl)-1,3-thiazol-4-yl]methyl 3-quinolin-2-ylprop-2-enoate?
The InChIKey is JJZSASXACJLCEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H15FN2O2S/c23-17-8-5-16(6-9-17)22-25-19(14-28-22)13-27-21(26)12-11-18-10-7-15-3-1-2-4-20(15)24-18/h1-12,14H,13H2.
What are the key properties of [2-(4-fluorophenyl)-1,3-thiazol-4-yl]methyl 3-quinolin-2-ylprop-2-enoate?
[2-(4-fluorophenyl)-1,3-thiazol-4-yl]methyl 3-quinolin-2-ylprop-2-enoate has a molecular weight of 390.44 g/mol, XLogP of 5.25, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(4-fluorophenyl)-1,3-thiazol-4-yl]methyl 3-quinolin-2-ylprop-2-enoate is sourced from PubChem (CID 71953116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).