C36H31NO8 — CID 71953583
(6,7-dihydroxy-2-oxochromen-4-yl)methyl 4-(1,3-benzodioxol-5-ylmethylidene)-2-tert-butyl-2,3-dihydro-1H-acridine-9-carboxylate (PubChem CID 71953583) has the molecular formula C36H31NO8 and a molecular weight of 605.64 g/mol. Its IUPAC name is (6,7-dihydroxy-2-oxochromen-4-yl)methyl 4-(1,3-benzodioxol-5-ylmethylidene)-2-tert-butyl-2,3-dihydro-1H-acridine-9-carboxylate.
| Compound Name | (6,7-dihydroxy-2-oxochromen-4-yl)methyl 4-(1,3-benzodioxol-5-ylmethylidene)-2-tert-butyl-2,3-dihydro-1H-acridine-9-carboxylate |
|---|---|
| PubChem CID | 71953583 |
| Molecular Formula | C36H31NO8 |
| Molecular Weight | 605.64 g/mol |
| Exact Mass | 605.20 |
| IUPAC Name | (6,7-dihydroxy-2-oxochromen-4-yl)methyl 4-(1,3-benzodioxol-5-ylmethylidene)-2-tert-butyl-2,3-dihydro-1H-acridine-9-carboxylate |
| SMILES | CC(C)(C)C1CC(=Cc2ccc3c(c2)OCO3)c2nc3ccccc3c(C(=O)OCc3cc(=O)oc4cc(O)c(O)cc34)c2C1 |
| InChI | InChI=1S/C36H31NO8/c1-36(2,3)22-12-20(10-19-8-9-29-31(11-19)44-18-43-29)34-25(14-22)33(23-6-4-5-7-26(23)37-34)35(41)42-17-21-13-32(40)45-30-16-28(39)27(38)15-24(21)30/h4-11,13,15-16,22,38-39H,12,14,17-18H2,1-3H3 |
| InChIKey | UWVGAGGHBUNQKK-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 128.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.64 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|