C9H13N4O4+ — CID 7195833
[(1R)-1,2-dicyano-2-iminoethyl]-[(2R,3R,4R,5R)-3,4,5-trihydroxyoxan-2-yl]azanium (PubChem CID 7195833) has the molecular formula C9H13N4O4+ and a molecular weight of 241.23 g/mol. Its IUPAC name is [(1R)-1,2-dicyano-2-iminoethyl]-[(2R,3R,4R,5R)-3,4,5-trihydroxyoxan-2-yl]azanium.
| Compound Name | [(1R)-1,2-dicyano-2-iminoethyl]-[(2R,3R,4R,5R)-3,4,5-trihydroxyoxan-2-yl]azanium |
|---|---|
| PubChem CID | 7195833 |
| Molecular Formula | C9H13N4O4+ |
| Molecular Weight | 241.23 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | [(1R)-1,2-dicyano-2-iminoethyl]-[(2R,3R,4R,5R)-3,4,5-trihydroxyoxan-2-yl]azanium |
| SMILES | [H]/N=C(\C#N)[C@H](C#N)[NH2+][C@@H]1OC[C@@H](O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C9H12N4O4/c10-1-4(12)5(2-11)13-9-8(16)7(15)6(14)3-17-9/h5-9,12-16H,3H2/p+1/b12-4+/t5-,6+,7+,8+,9+/m0/s1 |
| InChIKey | KXWIKNCIJBMFHU-ZOSKCKANSA-O |
| XLogP | -3.58 |
| TPSA | 157.96 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.23 |
| LogP ≤ 5 | -3.58 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|