C35H34N2O3S — CID 71959166
N-[(4S,10bS)-6-oxo-4-prop-1-enyl-2,3,4,10b-tetrahydro-1H-pyrido[2,1-a]isoindol-2-yl]-5-(4-phenoxyphenyl)-N-propylthiophene-2-carboxamide (PubChem CID 71959166) has the molecular formula C35H34N2O3S and a molecular weight of 562.74 g/mol. Its IUPAC name is N-[(4S,10bS)-6-oxo-4-prop-1-enyl-2,3,4,10b-tetrahydro-1H-pyrido[2,1-a]isoindol-2-yl]-5-(4-phenoxyphenyl)-N-propylthiophene-2-carboxamide.
| Compound Name | N-[(4S,10bS)-6-oxo-4-prop-1-enyl-2,3,4,10b-tetrahydro-1H-pyrido[2,1-a]isoindol-2-yl]-5-(4-phenoxyphenyl)-N-propylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 71959166 |
| Molecular Formula | C35H34N2O3S |
| Molecular Weight | 562.74 g/mol |
| Exact Mass | 562.23 |
| IUPAC Name | N-[(4S,10bS)-6-oxo-4-prop-1-enyl-2,3,4,10b-tetrahydro-1H-pyrido[2,1-a]isoindol-2-yl]-5-(4-phenoxyphenyl)-N-propylthiophene-2-carboxamide |
| SMILES | CC=C[C@@H]1CC(N(CCC)C(=O)c2ccc(-c3ccc(Oc4ccccc4)cc3)s2)C[C@H]2c3ccccc3C(=O)N12 |
| InChI | InChI=1S/C35H34N2O3S/c1-3-10-25-22-26(23-31-29-13-8-9-14-30(29)34(38)37(25)31)36(21-4-2)35(39)33-20-19-32(41-33)24-15-17-28(18-16-24)40-27-11-6-5-7-12-27/h3,5-20,25-26,31H,4,21-23H2,1-2H3/t25-,26?,31+/m1/s1 |
| InChIKey | FTKHMUKUCPBBOJ-UBEIWSTOSA-N |
| XLogP | 8.36 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.74 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|