C16H23NO2 — CID 71960774
N-(3-hydroxy-4,4-dimethylpentyl)-3-phenylprop-2-enamide (PubChem CID 71960774) has the molecular formula C16H23NO2 and a molecular weight of 261.37 g/mol. Its IUPAC name is N-(3-hydroxy-4,4-dimethylpentyl)-3-phenylprop-2-enamide.
| Compound Name | N-(3-hydroxy-4,4-dimethylpentyl)-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 71960774 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | N-(3-hydroxy-4,4-dimethylpentyl)-3-phenylprop-2-enamide |
| SMILES | CC(C)(C)C(O)CCNC(=O)C=Cc1ccccc1 |
| InChI | InChI=1S/C16H23NO2/c1-16(2,3)14(18)11-12-17-15(19)10-9-13-7-5-4-6-8-13/h4-10,14,18H,11-12H2,1-3H3,(H,17,19) |
| InChIKey | NCRWBDNHCDWNFD-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|