C14H26N2O2S — CID 719614
1-[[(1S)-cyclohex-3-en-1-yl]methyl]-4-propylsulfonylpiperazine (PubChem CID 719614) has the molecular formula C14H26N2O2S and a molecular weight of 286.44 g/mol. Its IUPAC name is 1-[[(1S)-cyclohex-3-en-1-yl]methyl]-4-propylsulfonylpiperazine.
| Compound Name | 1-[[(1S)-cyclohex-3-en-1-yl]methyl]-4-propylsulfonylpiperazine |
|---|---|
| PubChem CID | 719614 |
| Molecular Formula | C14H26N2O2S |
| Molecular Weight | 286.44 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | 1-[[(1S)-cyclohex-3-en-1-yl]methyl]-4-propylsulfonylpiperazine |
| SMILES | CCCS(=O)(=O)N1CCN(C[C@@H]2CC=CCC2)CC1 |
| InChI | InChI=1S/C14H26N2O2S/c1-2-12-19(17,18)16-10-8-15(9-11-16)13-14-6-4-3-5-7-14/h3-4,14H,2,5-13H2,1H3/t14-/m1/s1 |
| InChIKey | QSUYKINLPPFIRE-CQSZACIVSA-N |
| XLogP | 1.70 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.44 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|