About N-cyclopentyl-1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonamide
N-cyclopentyl-1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonamide (PubChem CID 7196320) has the molecular formula C11H17N3O4S
and a molecular weight of 287.34 g/mol. Its IUPAC name is N-cyclopentyl-1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonamide.
Molecular Properties
| Compound Name | N-cyclopentyl-1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonamide |
| PubChem CID | 7196320 |
| Molecular Formula | C11H17N3O4S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | N-cyclopentyl-1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonamide |
| SMILES | Cn1cc(S(=O)(=O)NC2CCCC2)c(=O)n(C)c1=O |
| InChI | InChI=1S/C11H17N3O4S/c1-13-7-9(10(15)14(2)11(13)16)19(17,18)12-8-5-3-4-6-8/h7-8,12H,3-6H2,1-2H3 |
| InChIKey | BABFVYIDFNMRCV-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 90.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-cyclopentyl-1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopentyl-1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonamide?
The IUPAC name of N-cyclopentyl-1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonamide (CID 7196320) is N-cyclopentyl-1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonamide.
What is the SMILES notation for N-cyclopentyl-1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonamide?
The canonical SMILES for N-cyclopentyl-1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonamide is Cn1cc(S(=O)(=O)NC2CCCC2)c(=O)n(C)c1=O.
What is the InChIKey of N-cyclopentyl-1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonamide?
The InChIKey is BABFVYIDFNMRCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N3O4S/c1-13-7-9(10(15)14(2)11(13)16)19(17,18)12-8-5-3-4-6-8/h7-8,12H,3-6H2,1-2H3.
What are the key properties of N-cyclopentyl-1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonamide?
N-cyclopentyl-1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonamide has a molecular weight of 287.34 g/mol, XLogP of -0.70, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopentyl-1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonamide is sourced from PubChem (CID 7196320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).