C16H19NO2 — CID 71964242
(1S,5R)-2-[1-(2-hydroxyanilino)ethylidene]-6,6-dimethylbicyclo[3.1.0]hexan-3-one (PubChem CID 71964242) has the molecular formula C16H19NO2 and a molecular weight of 257.33 g/mol. Its IUPAC name is (1S,5R)-2-[1-(2-hydroxyanilino)ethylidene]-6,6-dimethylbicyclo[3.1.0]hexan-3-one.
| Compound Name | (1S,5R)-2-[1-(2-hydroxyanilino)ethylidene]-6,6-dimethylbicyclo[3.1.0]hexan-3-one |
|---|---|
| PubChem CID | 71964242 |
| Molecular Formula | C16H19NO2 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | (1S,5R)-2-[1-(2-hydroxyanilino)ethylidene]-6,6-dimethylbicyclo[3.1.0]hexan-3-one |
| SMILES | CC(Nc1ccccc1O)=C1C(=O)C[C@@H]2[C@H]1C2(C)C |
| InChI | InChI=1S/C16H19NO2/c1-9(17-11-6-4-5-7-12(11)18)14-13(19)8-10-15(14)16(10,2)3/h4-7,10,15,17-18H,8H2,1-3H3/t10-,15-/m1/s1 |
| InChIKey | MVIFPORDNBDLFA-MEBBXXQBSA-N |
| XLogP | 3.32 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|