C14H17N3O4S — CID 7196425
N-benzyl-1,3,4-trimethyl-2,6-dioxopyrimidine-5-sulfonamide (PubChem CID 7196425) has the molecular formula C14H17N3O4S and a molecular weight of 323.37 g/mol. Its IUPAC name is N-benzyl-1,3,4-trimethyl-2,6-dioxopyrimidine-5-sulfonamide.
| Compound Name | N-benzyl-1,3,4-trimethyl-2,6-dioxopyrimidine-5-sulfonamide |
|---|---|
| PubChem CID | 7196425 |
| Molecular Formula | C14H17N3O4S |
| Molecular Weight | 323.37 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | N-benzyl-1,3,4-trimethyl-2,6-dioxopyrimidine-5-sulfonamide |
| SMILES | Cc1c(S(=O)(=O)NCc2ccccc2)c(=O)n(C)c(=O)n1C |
| InChI | InChI=1S/C14H17N3O4S/c1-10-12(13(18)17(3)14(19)16(10)2)22(20,21)15-9-11-7-5-4-6-8-11/h4-8,15H,9H2,1-3H3 |
| InChIKey | GLTVFHIBYLEFHC-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 90.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.37 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |