C22H17N3O3 — CID 71965790
N-[2-methoxy-5-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]-3-phenylprop-2-enamide (PubChem CID 71965790) has the molecular formula C22H17N3O3 and a molecular weight of 371.40 g/mol. Its IUPAC name is N-[2-methoxy-5-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]-3-phenylprop-2-enamide.
| Compound Name | N-[2-methoxy-5-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 71965790 |
| Molecular Formula | C22H17N3O3 |
| Molecular Weight | 371.40 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | N-[2-methoxy-5-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]-3-phenylprop-2-enamide |
| SMILES | COc1ccc(-c2nc3ncccc3o2)cc1NC(=O)C=Cc1ccccc1 |
| InChI | InChI=1S/C22H17N3O3/c1-27-18-11-10-16(22-25-21-19(28-22)8-5-13-23-21)14-17(18)24-20(26)12-9-15-6-3-2-4-7-15/h2-14H,1H3,(H,24,26) |
| InChIKey | UNMPHBYKGCUZLG-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.40 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|