About ethyl 2-[(8-methoxy-4-oxo-2,3-dihydrochromen-5-yl)hydrazinylidene]propanoate
ethyl 2-[(8-methoxy-4-oxo-2,3-dihydrochromen-5-yl)hydrazinylidene]propanoate (PubChem CID 71966752) has the molecular formula C15H18N2O5
and a molecular weight of 306.32 g/mol. Its IUPAC name is ethyl 2-[(8-methoxy-4-oxo-2,3-dihydrochromen-5-yl)hydrazinylidene]propanoate.
Molecular Properties
| Compound Name | ethyl 2-[(8-methoxy-4-oxo-2,3-dihydrochromen-5-yl)hydrazinylidene]propanoate |
| PubChem CID | 71966752 |
| Molecular Formula | C15H18N2O5 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | ethyl 2-[(8-methoxy-4-oxo-2,3-dihydrochromen-5-yl)hydrazinylidene]propanoate |
| SMILES | CCOC(=O)C(C)=NNc1ccc(OC)c2c1C(=O)CCO2 |
| InChI | InChI=1S/C15H18N2O5/c1-4-21-15(19)9(2)16-17-10-5-6-12(20-3)14-13(10)11(18)7-8-22-14/h5-6,17H,4,7-8H2,1-3H3 |
| InChIKey | LLGYNJXFUNPBER-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 86.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-[(8-methoxy-4-oxo-2,3-dihydrochromen-5-yl)hydrazinylidene]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[(8-methoxy-4-oxo-2,3-dihydrochromen-5-yl)hydrazinylidene]propanoate?
The IUPAC name of ethyl 2-[(8-methoxy-4-oxo-2,3-dihydrochromen-5-yl)hydrazinylidene]propanoate (CID 71966752) is ethyl 2-[(8-methoxy-4-oxo-2,3-dihydrochromen-5-yl)hydrazinylidene]propanoate.
What is the SMILES notation for ethyl 2-[(8-methoxy-4-oxo-2,3-dihydrochromen-5-yl)hydrazinylidene]propanoate?
The canonical SMILES for ethyl 2-[(8-methoxy-4-oxo-2,3-dihydrochromen-5-yl)hydrazinylidene]propanoate is CCOC(=O)C(C)=NNc1ccc(OC)c2c1C(=O)CCO2.
What is the InChIKey of ethyl 2-[(8-methoxy-4-oxo-2,3-dihydrochromen-5-yl)hydrazinylidene]propanoate?
The InChIKey is LLGYNJXFUNPBER-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N2O5/c1-4-21-15(19)9(2)16-17-10-5-6-12(20-3)14-13(10)11(18)7-8-22-14/h5-6,17H,4,7-8H2,1-3H3.
What are the key properties of ethyl 2-[(8-methoxy-4-oxo-2,3-dihydrochromen-5-yl)hydrazinylidene]propanoate?
ethyl 2-[(8-methoxy-4-oxo-2,3-dihydrochromen-5-yl)hydrazinylidene]propanoate has a molecular weight of 306.32 g/mol, XLogP of 2.01, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[(8-methoxy-4-oxo-2,3-dihydrochromen-5-yl)hydrazinylidene]propanoate is sourced from PubChem (CID 71966752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).