About (5-methyloxolan-2-yl)methyl 1,3-thiazole-4-carboxylate
(5-methyloxolan-2-yl)methyl 1,3-thiazole-4-carboxylate (PubChem CID 71967385) has the molecular formula C10H13NO3S
and a molecular weight of 227.28 g/mol. Its IUPAC name is (5-methyloxolan-2-yl)methyl 1,3-thiazole-4-carboxylate.
Molecular Properties
| Compound Name | (5-methyloxolan-2-yl)methyl 1,3-thiazole-4-carboxylate |
| PubChem CID | 71967385 |
| Molecular Formula | C10H13NO3S |
| Molecular Weight | 227.28 g/mol |
| Exact Mass | 227.06 |
| IUPAC Name | (5-methyloxolan-2-yl)methyl 1,3-thiazole-4-carboxylate |
| SMILES | CC1CCC(COC(=O)c2cscn2)O1 |
| InChI | InChI=1S/C10H13NO3S/c1-7-2-3-8(14-7)4-13-10(12)9-5-15-6-11-9/h5-8H,2-4H2,1H3 |
| InChIKey | IVKUDILQJHBHRI-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.28 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (5-methyloxolan-2-yl)methyl 1,3-thiazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-methyloxolan-2-yl)methyl 1,3-thiazole-4-carboxylate?
The IUPAC name of (5-methyloxolan-2-yl)methyl 1,3-thiazole-4-carboxylate (CID 71967385) is (5-methyloxolan-2-yl)methyl 1,3-thiazole-4-carboxylate.
What is the SMILES notation for (5-methyloxolan-2-yl)methyl 1,3-thiazole-4-carboxylate?
The canonical SMILES for (5-methyloxolan-2-yl)methyl 1,3-thiazole-4-carboxylate is CC1CCC(COC(=O)c2cscn2)O1.
What is the InChIKey of (5-methyloxolan-2-yl)methyl 1,3-thiazole-4-carboxylate?
The InChIKey is IVKUDILQJHBHRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO3S/c1-7-2-3-8(14-7)4-13-10(12)9-5-15-6-11-9/h5-8H,2-4H2,1H3.
What are the key properties of (5-methyloxolan-2-yl)methyl 1,3-thiazole-4-carboxylate?
(5-methyloxolan-2-yl)methyl 1,3-thiazole-4-carboxylate has a molecular weight of 227.28 g/mol, XLogP of 1.87, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5-methyloxolan-2-yl)methyl 1,3-thiazole-4-carboxylate is sourced from PubChem (CID 71967385), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).