C12H21F3N2O3S — CID 71967472
1-[(1,1-dioxothian-4-yl)methyl]-3-(5,5,5-trifluoropentyl)urea (PubChem CID 71967472) has the molecular formula C12H21F3N2O3S and a molecular weight of 330.37 g/mol. Its IUPAC name is 1-[(1,1-dioxothian-4-yl)methyl]-3-(5,5,5-trifluoropentyl)urea.
| Compound Name | 1-[(1,1-dioxothian-4-yl)methyl]-3-(5,5,5-trifluoropentyl)urea |
|---|---|
| PubChem CID | 71967472 |
| Molecular Formula | C12H21F3N2O3S |
| Molecular Weight | 330.37 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | 1-[(1,1-dioxothian-4-yl)methyl]-3-(5,5,5-trifluoropentyl)urea |
| SMILES | O=C(NCCCCC(F)(F)F)NCC1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C12H21F3N2O3S/c13-12(14,15)5-1-2-6-16-11(18)17-9-10-3-7-21(19,20)8-4-10/h10H,1-9H2,(H2,16,17,18) |
| InChIKey | KNSGUVHNTFTJOJ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.37 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|