About 2-(oxan-4-yl)-N-[2-(2,4,6-trimethylphenyl)ethyl]propanamide
2-(oxan-4-yl)-N-[2-(2,4,6-trimethylphenyl)ethyl]propanamide (PubChem CID 71967515) has the molecular formula C19H29NO2
and a molecular weight of 303.45 g/mol. Its IUPAC name is 2-(oxan-4-yl)-N-[2-(2,4,6-trimethylphenyl)ethyl]propanamide.
Molecular Properties
| Compound Name | 2-(oxan-4-yl)-N-[2-(2,4,6-trimethylphenyl)ethyl]propanamide |
| PubChem CID | 71967515 |
| Molecular Formula | C19H29NO2 |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.22 |
| IUPAC Name | 2-(oxan-4-yl)-N-[2-(2,4,6-trimethylphenyl)ethyl]propanamide |
| SMILES | Cc1cc(C)c(CCNC(=O)C(C)C2CCOCC2)c(C)c1 |
| InChI | InChI=1S/C19H29NO2/c1-13-11-14(2)18(15(3)12-13)5-8-20-19(21)16(4)17-6-9-22-10-7-17/h11-12,16-17H,5-10H2,1-4H3,(H,20,21) |
| InChIKey | XCCZKMLLQOANJI-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(oxan-4-yl)-N-[2-(2,4,6-trimethylphenyl)ethyl]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(oxan-4-yl)-N-[2-(2,4,6-trimethylphenyl)ethyl]propanamide?
The IUPAC name of 2-(oxan-4-yl)-N-[2-(2,4,6-trimethylphenyl)ethyl]propanamide (CID 71967515) is 2-(oxan-4-yl)-N-[2-(2,4,6-trimethylphenyl)ethyl]propanamide.
What is the SMILES notation for 2-(oxan-4-yl)-N-[2-(2,4,6-trimethylphenyl)ethyl]propanamide?
The canonical SMILES for 2-(oxan-4-yl)-N-[2-(2,4,6-trimethylphenyl)ethyl]propanamide is Cc1cc(C)c(CCNC(=O)C(C)C2CCOCC2)c(C)c1.
What is the InChIKey of 2-(oxan-4-yl)-N-[2-(2,4,6-trimethylphenyl)ethyl]propanamide?
The InChIKey is XCCZKMLLQOANJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H29NO2/c1-13-11-14(2)18(15(3)12-13)5-8-20-19(21)16(4)17-6-9-22-10-7-17/h11-12,16-17H,5-10H2,1-4H3,(H,20,21).
What are the key properties of 2-(oxan-4-yl)-N-[2-(2,4,6-trimethylphenyl)ethyl]propanamide?
2-(oxan-4-yl)-N-[2-(2,4,6-trimethylphenyl)ethyl]propanamide has a molecular weight of 303.45 g/mol, XLogP of 3.33, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(oxan-4-yl)-N-[2-(2,4,6-trimethylphenyl)ethyl]propanamide is sourced from PubChem (CID 71967515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).