C10H18ClNO2S — CID 71967798
N-(2-chloroprop-2-enyl)-N-methyl-2-methylsulfonylcyclopentan-1-amine (PubChem CID 71967798) has the molecular formula C10H18ClNO2S and a molecular weight of 251.78 g/mol. Its IUPAC name is N-(2-chloroprop-2-enyl)-N-methyl-2-methylsulfonylcyclopentan-1-amine.
| Compound Name | N-(2-chloroprop-2-enyl)-N-methyl-2-methylsulfonylcyclopentan-1-amine |
|---|---|
| PubChem CID | 71967798 |
| Molecular Formula | C10H18ClNO2S |
| Molecular Weight | 251.78 g/mol |
| Exact Mass | 251.07 |
| IUPAC Name | N-(2-chloroprop-2-enyl)-N-methyl-2-methylsulfonylcyclopentan-1-amine |
| SMILES | C=C(Cl)CN(C)C1CCCC1S(C)(=O)=O |
| InChI | InChI=1S/C10H18ClNO2S/c1-8(11)7-12(2)9-5-4-6-10(9)15(3,13)14/h9-10H,1,4-7H2,2-3H3 |
| InChIKey | FFSMKHLQHIVSPN-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.78 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |