About 2-(1,3,5-trimethylpyrazol-4-yl)ethyl 5-propyl-1H-pyrazole-3-carboxylate
2-(1,3,5-trimethylpyrazol-4-yl)ethyl 5-propyl-1H-pyrazole-3-carboxylate (PubChem CID 71967866) has the molecular formula C15H22N4O2
and a molecular weight of 290.37 g/mol. Its IUPAC name is 2-(1,3,5-trimethylpyrazol-4-yl)ethyl 5-propyl-1H-pyrazole-3-carboxylate.
Molecular Properties
| Compound Name | 2-(1,3,5-trimethylpyrazol-4-yl)ethyl 5-propyl-1H-pyrazole-3-carboxylate |
| PubChem CID | 71967866 |
| Molecular Formula | C15H22N4O2 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | 2-(1,3,5-trimethylpyrazol-4-yl)ethyl 5-propyl-1H-pyrazole-3-carboxylate |
| SMILES | CCCc1cc(C(=O)OCCc2c(C)nn(C)c2C)n[nH]1 |
| InChI | InChI=1S/C15H22N4O2/c1-5-6-12-9-14(17-16-12)15(20)21-8-7-13-10(2)18-19(4)11(13)3/h9H,5-8H2,1-4H3,(H,16,17) |
| InChIKey | HRWWAZGVDUYPPT-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(1,3,5-trimethylpyrazol-4-yl)ethyl 5-propyl-1H-pyrazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3,5-trimethylpyrazol-4-yl)ethyl 5-propyl-1H-pyrazole-3-carboxylate?
The IUPAC name of 2-(1,3,5-trimethylpyrazol-4-yl)ethyl 5-propyl-1H-pyrazole-3-carboxylate (CID 71967866) is 2-(1,3,5-trimethylpyrazol-4-yl)ethyl 5-propyl-1H-pyrazole-3-carboxylate.
What is the SMILES notation for 2-(1,3,5-trimethylpyrazol-4-yl)ethyl 5-propyl-1H-pyrazole-3-carboxylate?
The canonical SMILES for 2-(1,3,5-trimethylpyrazol-4-yl)ethyl 5-propyl-1H-pyrazole-3-carboxylate is CCCc1cc(C(=O)OCCc2c(C)nn(C)c2C)n[nH]1.
What is the InChIKey of 2-(1,3,5-trimethylpyrazol-4-yl)ethyl 5-propyl-1H-pyrazole-3-carboxylate?
The InChIKey is HRWWAZGVDUYPPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N4O2/c1-5-6-12-9-14(17-16-12)15(20)21-8-7-13-10(2)18-19(4)11(13)3/h9H,5-8H2,1-4H3,(H,16,17).
What are the key properties of 2-(1,3,5-trimethylpyrazol-4-yl)ethyl 5-propyl-1H-pyrazole-3-carboxylate?
2-(1,3,5-trimethylpyrazol-4-yl)ethyl 5-propyl-1H-pyrazole-3-carboxylate has a molecular weight of 290.37 g/mol, XLogP of 2.11, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3,5-trimethylpyrazol-4-yl)ethyl 5-propyl-1H-pyrazole-3-carboxylate is sourced from PubChem (CID 71967866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).