C17H17FN4O — CID 71967975
3-(2-fluoroethoxy)-N-[(5-pyridin-3-yl-1H-pyrazol-4-yl)methyl]aniline (PubChem CID 71967975) has the molecular formula C17H17FN4O and a molecular weight of 312.35 g/mol. Its IUPAC name is 3-(2-fluoroethoxy)-N-[(5-pyridin-3-yl-1H-pyrazol-4-yl)methyl]aniline.
| Compound Name | 3-(2-fluoroethoxy)-N-[(5-pyridin-3-yl-1H-pyrazol-4-yl)methyl]aniline |
|---|---|
| PubChem CID | 71967975 |
| Molecular Formula | C17H17FN4O |
| Molecular Weight | 312.35 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | 3-(2-fluoroethoxy)-N-[(5-pyridin-3-yl-1H-pyrazol-4-yl)methyl]aniline |
| SMILES | FCCOc1cccc(NCc2cn[nH]c2-c2cccnc2)c1 |
| InChI | InChI=1S/C17H17FN4O/c18-6-8-23-16-5-1-4-15(9-16)20-11-14-12-21-22-17(14)13-3-2-7-19-10-13/h1-5,7,9-10,12,20H,6,8,11H2,(H,21,22) |
| InChIKey | UWXPQXMNBDTMEF-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.35 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |