About 2,3-dipyridin-2-ylpyrazine
2,3-dipyridin-2-ylpyrazine (PubChem CID 719680) has the molecular formula C14H10N4
and a molecular weight of 234.26 g/mol. Its IUPAC name is 2,3-dipyridin-2-ylpyrazine.
Molecular Properties
| Compound Name | 2,3-dipyridin-2-ylpyrazine |
| PubChem CID | 719680 |
| Molecular Formula | C14H10N4 |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | 2,3-dipyridin-2-ylpyrazine |
| SMILES | c1ccc(-c2nccnc2-c2ccccn2)nc1 |
| InChI | InChI=1S/C14H10N4/c1-3-7-15-11(5-1)13-14(18-10-9-17-13)12-6-2-4-8-16-12/h1-10H |
| InChIKey | WTZDTUCKEBDJIM-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,3-dipyridin-2-ylpyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dipyridin-2-ylpyrazine?
The IUPAC name of 2,3-dipyridin-2-ylpyrazine (CID 719680) is 2,3-dipyridin-2-ylpyrazine.
What is the SMILES notation for 2,3-dipyridin-2-ylpyrazine?
The canonical SMILES for 2,3-dipyridin-2-ylpyrazine is c1ccc(-c2nccnc2-c2ccccn2)nc1.
What is the InChIKey of 2,3-dipyridin-2-ylpyrazine?
The InChIKey is WTZDTUCKEBDJIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10N4/c1-3-7-15-11(5-1)13-14(18-10-9-17-13)12-6-2-4-8-16-12/h1-10H.
What are the key properties of 2,3-dipyridin-2-ylpyrazine?
2,3-dipyridin-2-ylpyrazine has a molecular weight of 234.26 g/mol, XLogP of 2.60, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dipyridin-2-ylpyrazine is sourced from PubChem (CID 719680), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).